ChemNet > CAS > 6345-55-7 5-nitro-1-benzothiophene-2-carboxylic acid
6345-55-7 5-nitro-1-benzothiophene-2-carboxylic acid
| product Name |
5-nitro-1-benzothiophene-2-carboxylic acid |
| CAS No |
6345-55-7 |
| Synonyms |
5-nitro-1-benzothiophene-2-carboxylate |
| Molecular Formula |
C9H4NO4S |
| Molecular Weight |
222.1979 |
| InChI |
InChI=1/C9H5NO4S/c11-9(12)8-4-5-3-6(10(13)14)1-2-7(5)15-8/h1-4H,(H,11,12)/p-1 |
| Molecular Structure |
|
| Melting point |
238℃ |
| Boiling point |
473.6°C at 760 mmHg |
| Flash point |
240.2°C |
| Vapour Pressur |
8.93E-10mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
