ChemNet > CAS > 635-10-9 Tetramethyl 1,2,4,5-Benzenetetracarboxylate
635-10-9 Tetramethyl 1,2,4,5-Benzenetetracarboxylate
| product Name |
Tetramethyl 1,2,4,5-Benzenetetracarboxylate |
| CAS No |
635-10-9 |
| Synonyms |
Tetramethyl pyromellitate; Pyromellitic acid tetramethyl ester~Tetramethyl benzene-1,2,4,5-tetracarboxylate; tetramethyl benzene-1,2,4,5-tetracarboxylate |
| Molecular Formula |
C14H14O8 |
| Molecular Weight |
310.2562 |
| InChI |
InChI=1/C14H14O8/c1-19-11(15)7-5-9(13(17)21-3)10(14(18)22-4)6-8(7)12(16)20-2/h5-6H,1-4H3 |
| EINECS |
211-226-6 |
| Molecular Structure |
|
| Density |
1.287g/cm3 |
| Boiling point |
370.9°C at 760 mmHg |
| Refractive index |
1.52 |
| Flash point |
161.5°C |
| Vapour Pressur |
1.07E-05mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
