ChemNet > CAS > 635-12-1 1,4-Anthraquinone
635-12-1 1,4-Anthraquinone
| product Name |
1,4-Anthraquinone |
| CAS No |
635-12-1 |
| Synonyms |
1,4-Dioxoanthracene; 1,4-Anthracenedione; anthracene-1,4-dione |
| Molecular Formula |
C14H8O2 |
| Molecular Weight |
208.2121 |
| InChI |
InChI=1/C14H8O2/c15-13-5-6-14(16)12-8-10-4-2-1-3-9(10)7-11(12)13/h1-8H |
| EINECS |
211-228-7 |
| Molecular Structure |
|
| Density |
1.328g/cm3 |
| Boiling point |
406°C at 760 mmHg |
| Refractive index |
1.702 |
| Flash point |
152°C |
| Vapour Pressur |
8.39E-07mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
