ChemNet > CAS > 636-26-0 5-methyl-2-thiouracil
636-26-0 5-methyl-2-thiouracil
| product Name |
5-methyl-2-thiouracil |
| CAS No |
636-26-0 |
| Synonyms |
4-Hydroxy-2-mercapto-5-methylpyrimidine; 2-Thiothymine; 5-methyl-2-thioxo-2,3-dihydropyrimidin-4(1H)-one |
| Molecular Formula |
C5H6N2OS |
| Molecular Weight |
142.1789 |
| InChI |
InChI=1/C5H6N2OS/c1-3-2-6-5(9)7-4(3)8/h2H,1H3,(H2,6,7,8,9) |
| Molecular Structure |
|
| Density |
1.36g/cm3 |
| Melting point |
265-267℃ |
| Boiling point |
329.7°C at 760 mmHg |
| Refractive index |
1.638 |
| Flash point |
153.2°C |
| Vapour Pressur |
9.11E-05mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R22:Harmful if swallowed.;
R40:Possible risks of irreversible effects.;
|
| Safety Description |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|
