ChemNet > CAS > 637-39-8 Triethanolamine hydrochloride
637-39-8 Triethanolamine hydrochloride
| product Name |
Triethanolamine hydrochloride |
| Synonyms |
2,2,2-Nitrilotriethanol hydrochloride~Tris(2-hydroxyethyl)amine hydrochloride; triethanolamine hcl; tris(2-hydroxyethyl)ammonium chloride; 2,2',2''-nitrilotriethanol hydrochloride (1:1) |
| Molecular Formula |
C6H16ClNO3 |
| Molecular Weight |
185.6491 |
| InChI |
InChI=1/C6H15NO3.ClH/c8-4-1-7(2-5-9)3-6-10;/h8-10H,1-6H2;1H |
| CAS Registry Number |
637-39-8 |
| EINECS |
211-284-2 |
| Molecular Structure |
|
| Melting point |
177-179℃ |
| Boiling point |
335.4°C at 760 mmHg |
| Flash point |
185°C |
| Vapour Pressur |
8.38E-06mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Triethanolamine hydrochloride Material Safety Data Sheet
|
|
