ChemNet > CAS > 637-64-9 Tetrahydrofurfuryl acetate
637-64-9 Tetrahydrofurfuryl acetate
| product Name |
Tetrahydrofurfuryl acetate |
| CAS No |
637-64-9 |
| Synonyms |
Acetic acid tetrahydrofurfuryl ester; Tetrahydro-2-furanmethanol acetate; (2R)-tetrahydrofuran-2-ylmethyl acetate; (2S)-tetrahydrofuran-2-ylmethyl acetate |
| Molecular Formula |
C7H12O3 |
| Molecular Weight |
144.1684 |
| InChI |
InChI=1/C7H12O3/c1-6(8)10-5-7-3-2-4-9-7/h7H,2-5H2,1H3/t7-/m0/s1 |
| EINECS |
211-296-8 |
| Molecular Structure |
|
| Density |
1.049g/cm3 |
| Boiling point |
205.5°C at 760 mmHg |
| Refractive index |
1.434 |
| Flash point |
84.4°C |
| Vapour Pressur |
0.249mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|
