ChemNet > CAS > 63762-78-7 2-Fluoro-5-methylanisole
63762-78-7 2-Fluoro-5-methylanisole
| product Name |
2-Fluoro-5-methylanisole |
| Synonyms |
Fluoromethylanisole1; 4-Fluoro-3-methoxytoluene; 1-fluoro-2-methoxy-4-methylbenzene |
| Molecular Formula |
C8H9FO |
| Molecular Weight |
140.1549 |
| InChI |
InChI=1/C8H9FO/c1-6-3-4-7(9)8(5-6)10-2/h3-5H,1-2H3 |
| CAS Registry Number |
63762-78-7 |
| Molecular Structure |
|
| Density |
1.046g/cm3 |
| Boiling point |
182.5°C at 760 mmHg |
| Refractive index |
1.475 |
| Flash point |
63.7°C |
| Vapour Pressur |
1.1mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R10:Flammable.;
|
| Safety Description |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|
