ChemNet > CAS > 6396-76-5 1-(2,6-Dimethylphenyl)-thiourea
6396-76-5 1-(2,6-Dimethylphenyl)-thiourea
| product Name |
1-(2,6-Dimethylphenyl)-thiourea |
| CAS No |
6396-76-5 |
| Synonyms |
2,6-Dimethylphenylthiourea |
| Molecular Formula |
C9H12N2S |
| Molecular Weight |
180.27 |
| InChI |
InChI=1/C9H12N2S/c1-6-4-3-5-7(2)8(6)11-9(10)12/h3-5H,1-2H3,(H3,10,11,12) |
| EINECS |
229-005-8 |
| Molecular Structure |
|
| Density |
1.2g/cm3 |
| Boiling point |
284.4°C at 760 mmHg |
| Refractive index |
1.674 |
| Flash point |
125.8°C |
| Vapour Pressur |
0.00298mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R25:Toxic if swallowed.;
|
| Safety Description |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
