ChemNet > CAS > 640-19-7 Fluoroacetamide
640-19-7 Fluoroacetamide
| product Name |
Fluoroacetamide |
| CAS No |
640-19-7 |
| Synonyms |
1081; 2-Fluoroacetamide; 4-02-00-00454 (Beilstein Handbook Reference); AFL 1081; AI3-25667; Amid kyseliny fluoroctove; Amid kyseliny fluoroctove [Czech]; BRN 1739054; Baran; Caswell No. 461; Compound 1081; EPA Pesticide Chemical Code 075002; FAA; Fluorakil 100; Fluorkill; Fluoroacetic acid amide; Fluoroakil 100; Flutritex 1; Fussol; HSDB 2880; Megatox; Monofluoroacetamide; NSC 31876; Navron; RCRA waste number P057; Yanock; Acetamide, 2-fluoro-; RCRA waste no. P057 |
| Molecular Formula |
C2H4FNO |
| Molecular Weight |
77.0577 |
| InChI |
InChI=1/C2H4FNO/c3-1-2(4)5/h1H2,(H2,4,5) |
| EINECS |
211-363-1 |
| Molecular Structure |
|
| Density |
1.136g/cm3 |
| Melting point |
106-109℃ |
| Boiling point |
259°C at 760 mmHg |
| Refractive index |
1.362 |
| Flash point |
110.4°C |
| Vapour Pressur |
0.0133mmHg at 25°C |
| Hazard Symbols |
 T+:Very toxic;
|
| Risk Codes |
R24:Toxic in contact with skin.;
R28:Very toxic if swallowed.;
|
| Safety Description |
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
| MSDS |
Material Safety Data Sheet
|
|
