ChemNet > CAS > 6402-36-4 trans-Traumatic acid
6402-36-4 trans-Traumatic acid
| product Name |
trans-Traumatic acid |
| CAS No |
6402-36-4 |
| Molecular Formula |
C12H18O4 |
| Molecular Weight |
226.27 |
| InChI |
InChI=1/C12H20O4/c13-11(14)9-7-5-3-1-2-4-6-8-10-12(15)16/h7,9H,1-6,8,10H2,(H,13,14)(H,15,16)/p-2 |
| EINECS |
229-019-4 |
| Molecular Structure |
|
| Melting point |
165-167℃ |
| Boiling point |
376.4°C at 760 mmHg |
| Flash point |
195.6°C |
| Vapour Pressur |
1.05E-06mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
