ChemNet > CAS > 64038-64-8 ethyl 2-mercapto-1H-imidazole-4-carboxylate
64038-64-8 ethyl 2-mercapto-1H-imidazole-4-carboxylate
| product Name |
ethyl 2-mercapto-1H-imidazole-4-carboxylate |
| CAS No |
64038-64-8 |
| Synonyms |
ethyl 2-thioxo-2,3-dihydro-1H-imidazole-4-carboxylate |
| Molecular Formula |
C6H8N2O2S |
| Molecular Weight |
172.2049 |
| InChI |
InChI=1/C6H8N2O2S/c1-2-10-5(9)4-3-7-6(11)8-4/h3H,2H2,1H3,(H2,7,8,11) |
| Molecular Structure |
|
| Density |
1.35g/cm3 |
| Melting point |
191℃ |
| Boiling point |
254.3°C at 760 mmHg |
| Refractive index |
1.605 |
| Flash point |
107.6°C |
| Vapour Pressur |
0.0174mmHg at 25°C |
| Hazard Symbols |
Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|