ChemNet > CAS > 64091-91-4 4-(N-Nitrosomethylamino)-1-(3-pyridyl)-1-butanone
64091-91-4 4-(N-Nitrosomethylamino)-1-(3-pyridyl)-1-butanone
| product Name |
4-(N-Nitrosomethylamino)-1-(3-pyridyl)-1-butanone |
| CAS No |
64091-91-4 |
| Synonyms |
NNK; 4-(N-Methyl-N-nitrosamino)-1-(3-pyridyl)-1-butanone; 4-[methyl(nitroso)amino]-1-(pyridin-3-yl)butan-1-one; 4-[methyl(nitroso)amino]-4-(pyridin-3-yl)butanal; 4-[(nitrosomethyl)amino]-1-(pyridin-3-yl)butan-1-one |
| Molecular Formula |
C10H13N3O2 |
| Molecular Weight |
207.2291 |
| InChI |
InChI=1/C10H13N3O2/c14-10(4-2-6-12-8-13-15)9-3-1-5-11-7-9/h1,3,5,7,12H,2,4,6,8H2 |
| Molecular Structure |
|
| Density |
1.192g/cm3 |
| Boiling point |
361.605°C at 760 mmHg |
| Refractive index |
1.569 |
| Flash point |
172.493°C |
| Vapour Pressur |
0mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R26/27/28:Very toxic by inhalation, in contact with skin and if swallowed.;
R45:May cause cancer.;
|
| Safety Description |
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
S53:Avoid exposure - obtain special instructions before use.;
|
|
