ChemNet > CAS > 64123-77-9 Methyl 3-fluorophenylacetate
64123-77-9 Methyl 3-fluorophenylacetate
| product Name |
Methyl 3-fluorophenylacetate |
| CAS No |
64123-77-9 |
| Molecular Formula |
C9H9FO2 |
| Molecular Weight |
168.165 |
| InChI |
InChI=1/C9H9FO2/c1-12-9(11)6-7-3-2-4-8(10)5-7/h2-5H,6H2,1H3 |
| Molecular Structure |
|
| Density |
1.148g/cm3 |
| Boiling point |
204°C at 760 mmHg |
| Refractive index |
1.488 |
| Flash point |
75.3°C |
| Vapour Pressur |
0.27mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
