ChemNet > CAS > 64218-50-4 2-chloro-1-(4,5-dichloro-2-thienyl)ethan-1-one
64218-50-4 2-chloro-1-(4,5-dichloro-2-thienyl)ethan-1-one
| product Name |
2-chloro-1-(4,5-dichloro-2-thienyl)ethan-1-one |
| CAS No |
64218-50-4 |
| Synonyms |
2-chloro-1-(4,5-dichlorothiophen-2-yl)ethanone |
| Molecular Formula |
C6H3Cl3OS |
| Molecular Weight |
229.5114 |
| InChI |
InChI=1/C6H3Cl3OS/c7-2-4(10)5-1-3(8)6(9)11-5/h1H,2H2 |
| Molecular Structure |
|
| Density |
1.574g/cm3 |
| Melting point |
56℃ |
| Boiling point |
355.8°C at 760 mmHg |
| Refractive index |
1.591 |
| Flash point |
169°C |
| Vapour Pressur |
3.05E-05mmHg at 25°C |
| Hazard Symbols |
 C:Corrosive;
|
| Risk Codes |
R34:Causes burns.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
| MSDS |
Material Safety Data Sheet
|
|
