ChemNet > CAS > 6436-59-5 Ethyl 2-methylthiazole-4-carboxylate
6436-59-5 Ethyl 2-methylthiazole-4-carboxylate
| product Name |
Ethyl 2-methylthiazole-4-carboxylate |
| CAS No |
6436-59-5 |
| Synonyms |
Ethyl 2-methyl-1,3-thiazole-4-carboxylate |
| Molecular Formula |
C7H9NO2S |
| Molecular Weight |
171.2169 |
| InChI |
InChI=1/C7H9NO2S/c1-3-10-7(9)6-4-11-5(2)8-6/h4H,3H2,1-2H3 |
| Molecular Structure |
|
| Density |
1.199g/cm3 |
| Melting point |
54-56℃ |
| Boiling point |
242.127°C at 760 mmHg |
| Refractive index |
1.528 |
| Flash point |
100.235°C |
| Vapour Pressur |
0.035mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
