ChemNet > CAS > 64399-27-5 1-(4-Chlorophenyl)-1-cyclopropanecarbonitrile
64399-27-5 1-(4-Chlorophenyl)-1-cyclopropanecarbonitrile
| product Name |
1-(4-Chlorophenyl)-1-cyclopropanecarbonitrile |
| CAS No |
64399-27-5 |
| Synonyms |
1-(p-Chlorophenyl)cyclopropanecarbonitrile; 1-(4-chlorophenyl)cyclopropanecarbonitrile |
| Molecular Formula |
C10H8ClN |
| Molecular Weight |
177.6302 |
| InChI |
InChI=1/C10H8ClN/c11-9-3-1-8(2-4-9)10(7-12)5-6-10/h1-4H,5-6H2 |
| EINECS |
264-871-0 |
| Molecular Structure |
|
| Density |
1.24g/cm3 |
| Melting point |
52-56℃ |
| Boiling point |
303.1°C at 760 mmHg |
| Refractive index |
1.589 |
| Flash point |
133.1°C |
| Vapour Pressur |
0.000947mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
