ChemNet > CAS > 644-13-3 2'-benzonaphthone
644-13-3 2'-benzonaphthone
| product Name |
2'-benzonaphthone |
| CAS No |
644-13-3 |
| Synonyms |
Methanone, 2-naphthalenylphenyl-; 2-Benzonaphthone; 2-Benzoylnaphthalene; 2-Naphthyl phenyl ketone; Ketone, 2-naphthyl phenyl; NSC 5190; beta-Benzoylnaphthalene; 2'-Benzonaphthone; naphthalen-2-yl(phenyl)methanone |
| Molecular Formula |
C17H12O |
| Molecular Weight |
232.2766 |
| InChI |
InChI=1/C17H12O/c18-17(14-7-2-1-3-8-14)16-11-10-13-6-4-5-9-15(13)12-16/h1-12H |
| EINECS |
211-410-6 |
| Molecular Structure |
|
| Density |
1.151g/cm3 |
| Melting point |
76-82℃ |
| Boiling point |
384.1°C at 760 mmHg |
| Refractive index |
1.653 |
| Flash point |
174.7°C |
| Vapour Pressur |
4.2E-06mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
