ChemNet > CAS > 646-01-5 3-(Methylthio)propionic acid
646-01-5 3-(Methylthio)propionic acid
| product Name |
3-(Methylthio)propionic acid |
| CAS No |
646-01-5 |
| Synonyms |
3-Methythiopropionic acid; 3-(methylsulfanyl)propanoate; 3-Methylthiopropionic Acid |
| Molecular Formula |
C4H7O2S |
| Molecular Weight |
119.1627 |
| InChI |
InChI=1/C4H8O2S/c1-7-3-2-4(5)6/h2-3H2,1H3,(H,5,6)/p-1 |
| EINECS |
211-460-9 |
| Molecular Structure |
|
| Boiling point |
249.2°C at 760 mmHg |
| Flash point |
104.5°C |
| Vapour Pressur |
0.00741mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R34:Causes burns.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
