ChemNet > CAS > 646-58-2 trifluoromethanesulphonic acid, compound with triethylamine (1:1)
646-58-2 trifluoromethanesulphonic acid, compound with triethylamine (1:1)
| product Name |
trifluoromethanesulphonic acid, compound with triethylamine (1:1) |
| CAS No |
646-58-2 |
| Synonyms |
Methanesulfonic acid, 1,1,1-trifluoro-, ompd. with N,N-diethylethanamine (1:1); Triethylamine salt of trifluoromethanesulfonic acid; Methanesulfonic acid, trifluoro-, compd. with N,N-diethylethanamine (1:1); Trifluoromethanesulphonic acid, compound with triethylamine (1:1); trifluoromethanesulfonic acid - N,N-diethylethanamine (1:1) |
| Molecular Formula |
C7H16F3NO3S |
| Molecular Weight |
251.267 |
| InChI |
InChI=1/C6H15N.CHF3O3S/c1-4-7(5-2)6-3;2-1(3,4)8(5,6)7/h4-6H2,1-3H3;(H,5,6,7) |
| EINECS |
211-475-0 |
| Molecular Structure |
|
| Boiling point |
162°C at 760 mmHg |
| Flash point |
109.5°C |
| Vapour Pressur |
1.14mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|
