ChemNet > CAS > 64601-13-4 octanoic acid, compound with 2-(isopropylamino)ethanol (1:1)
64601-13-4 octanoic acid, compound with 2-(isopropylamino)ethanol (1:1)
| product Name |
octanoic acid, compound with 2-(isopropylamino)ethanol (1:1) |
| CAS No |
64601-13-4 |
| Synonyms |
Octanoic acid, compd. with 2-((1-methylethyl)amino)ethanol (1:1); Caprylic acid, isopropylaminoethanol salt; Octanoic acid, compound with 2-(isopropylamino)ethanol (1:1); octanoic acid - 2-(propan-2-ylamino)ethanol (1:1) |
| Molecular Formula |
C13H29NO3 |
| Molecular Weight |
247.3743 |
| InChI |
InChI=1/C8H16O2.C5H13NO/c1-2-3-4-5-6-7-8(9)10;1-5(2)6-3-4-7/h2-7H2,1H3,(H,9,10);5-7H,3-4H2,1-2H3 |
| EINECS |
264-958-3 |
| Molecular Structure |
|
| Boiling point |
239.3°C at 760 mmHg |
| Flash point |
107.4°C |
| Vapour Pressur |
0.022mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|
