ChemNet > CAS > 6483-50-7 1,4-Diethylpiperazine
6483-50-7 1,4-Diethylpiperazine
| product Name |
1,4-Diethylpiperazine |
| CAS No |
6483-50-7 |
| Synonyms |
Piperazine, 1,4-diethyl-; 1,4-diethylpiperazinediium |
| Molecular Formula |
C8H20N2 |
| Molecular Weight |
144.2567 |
| InChI |
InChI=1/C8H18N2/c1-3-9-5-7-10(4-2)8-6-9/h3-8H2,1-2H3/p+2 |
| EINECS |
229-341-5 |
| Molecular Structure |
|
| Boiling point |
185°C at 760 mmHg |
| Flash point |
58.1°C |
| Vapour Pressur |
0.714mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
