ChemNet > CAS > 64910-46-9 3-amino-4-(methylamino)benzonitrile
64910-46-9 3-amino-4-(methylamino)benzonitrile
| product Name |
3-amino-4-(methylamino)benzonitrile |
| CAS No |
64910-46-9 |
| Molecular Formula |
C8H9N3 |
| Molecular Weight |
147.1772 |
| InChI |
InChI=1/C8H9N3/c1-11-8-3-2-6(5-9)4-7(8)10/h2-4,11H,10H2,1H3 |
| Molecular Structure |
|
| Density |
1.155g/cm3 |
| Melting point |
136℃ |
| Boiling point |
346.783°C at 760 mmHg |
| Refractive index |
1.593 |
| Flash point |
163.529°C |
| Vapour Pressur |
0mmHg at 25°C |
| Hazard Symbols |
 Xn:Harmful;
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Safety Description |
S36/37:Wear suitable protective clothing and gloves.;
|
| MSDS |
Material Safety Data Sheet
|
|
