ChemNet > CAS > 6496-89-5 2,4-Dimethoxyphenylacetic acid
6496-89-5 2,4-Dimethoxyphenylacetic acid
| product Name |
2,4-Dimethoxyphenylacetic acid |
| CAS No |
6496-89-5 |
| Synonyms |
(2,4-dimethoxyphenyl)acetate |
| Molecular Formula |
C10H12O4 |
| Molecular Weight |
195.1925 |
| InChI |
InChI=1/C10H12O4/c1-13-8-4-3-7(5-10(11)12)9(6-8)14-2/h3-4,6H,5H2,1-2H3,(H,11,12)/p-1 |
| Molecular Structure |
|
| Melting point |
110-113℃ |
| Boiling point |
339.7°C at 760 mmHg |
| Flash point |
134.1°C |
| Vapour Pressur |
3.5E-05mmHg at 25°C |
| Hazard Symbols |
 Xn:Harmful;
|
| Risk Codes |
R22:;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
