ChemNet > CAS > 65195-20-2 2-Piperidinophenol
65195-20-2 2-Piperidinophenol
| product Name |
2-Piperidinophenol |
| CAS No |
65195-20-2 |
| Synonyms |
2-(Piperidin-1-yl)phenol; phenol, 2-(1-piperidinyl)- |
| Molecular Formula |
C11H15NO |
| Molecular Weight |
177.2429 |
| InChI |
InChI=1/C11H15NO/c13-11-7-3-2-6-10(11)12-8-4-1-5-9-12/h2-3,6-7,13H,1,4-5,8-9H2 |
| Molecular Structure |
|
| Density |
1.106g/cm3 |
| Boiling point |
296.8°C at 760 mmHg |
| Refractive index |
1.575 |
| Flash point |
145.3°C |
| Vapour Pressur |
0.000795mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
