ChemNet > CAS > 6523-49-5 4-(1H-1,2,4-triazol-1-yl)aniline
6523-49-5 4-(1H-1,2,4-triazol-1-yl)aniline
| product Name |
4-(1H-1,2,4-triazol-1-yl)aniline |
| CAS No |
6523-49-5 |
| Synonyms |
1-(4'-Aminophenyl)-1,2,4-Triazole |
| Molecular Formula |
C8H8N4 |
| Molecular Weight |
160.1759 |
| InChI |
InChI=1/C8H8N4/c9-7-1-3-8(4-2-7)12-6-10-5-11-12/h1-6H,9H2 |
| Molecular Structure |
|
| Density |
1.32g/cm3 |
| Melting point |
143℃ |
| Boiling point |
375.3°C at 760 mmHg |
| Refractive index |
1.689 |
| Flash point |
180.8°C |
| Vapour Pressur |
7.87E-06mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
