ChemNet > CAS > 653-11-2 2,3,5,6-Tetrafluorophenylhydrazine
653-11-2 2,3,5,6-Tetrafluorophenylhydrazine
| product Name |
2,3,5,6-Tetrafluorophenylhydrazine |
| CAS No |
653-11-2 |
| Molecular Formula |
C6H4F4N2 |
| Molecular Weight |
180.103 |
| InChI |
InChI=1/C6H4F4N2/c7-2-1-3(8)5(10)6(12-11)4(2)9/h1,12H,11H2 |
| EINECS |
211-494-4 |
| Molecular Structure |
|
| Density |
1.595g/cm3 |
| Melting point |
89-93℃ |
| Boiling point |
136.3°C at 760 mmHg |
| Refractive index |
1.527 |
| Flash point |
36.2°C |
| Vapour Pressur |
7.43mmHg at 25°C |
| Hazard Symbols |
 Xn:Harmful;
|
| Risk Codes |
R20/21:Harmful by inhalation and in contact with skin.;
|
| Safety Description |
S23:Do not inhale gas/fumes/vapour/spray.;
|
| MSDS |
Material Safety Data Sheet
|
|
