ChemNet > CAS > 65369-29-1 4-methoxythiophene-3-carboxamide
65369-29-1 4-methoxythiophene-3-carboxamide
| product Name |
4-methoxythiophene-3-carboxamide |
| CAS No |
65369-29-1 |
| Molecular Formula |
C6H7NO2S |
| Molecular Weight |
157.1903 |
| InChI |
InChI=1/C6H7NO2S/c1-9-5-3-10-2-4(5)6(7)8/h2-3H,1H3,(H2,7,8) |
| Molecular Structure |
|
| Density |
1.292g/cm3 |
| Melting point |
118℃ |
| Boiling point |
304.9°C at 760 mmHg |
| Refractive index |
1.576 |
| Flash point |
138.2°C |
| Vapour Pressur |
0.000852mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
