ChemNet > CAS > 65371-88-2 3,6-Di-O-acetyl-4-O-benzyl-D-glucal
65371-88-2 3,6-Di-O-acetyl-4-O-benzyl-D-glucal
| product Name |
3,6-Di-O-acetyl-4-O-benzyl-D-glucal |
| CAS No |
65371-88-2 |
| Synonyms |
3,6-di-O-acetyl-1,5-anhydro-4-O-benzyl-2-deoxy-D-arabino-hex-1-enitol |
| Molecular Formula |
C17H20O6 |
| Molecular Weight |
320.3371 |
| InChI |
InChI=1/C17H20O6/c1-12(18)21-11-16-17(15(8-9-20-16)23-13(2)19)22-10-14-6-4-3-5-7-14/h3-9,15-17H,10-11H2,1-2H3/t15-,16-,17+/m1/s1 |
| Molecular Structure |
|
| Density |
1.2g/cm3 |
| Boiling point |
416.6°C at 760 mmHg |
| Refractive index |
1.535 |
| Flash point |
182°C |
| Vapour Pressur |
3.78E-07mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
