ChemNet > CAS > 6548-09-0 5-Bromo-DL-tryptophan
6548-09-0 5-Bromo-DL-tryptophan
| product Name |
5-Bromo-DL-tryptophan |
| CAS No |
6548-09-0 |
| Synonyms |
2-Amino-3-(5-bromo-1H-indol-3-yl)propanoic acid; 5-bromotryptophan |
| Molecular Formula |
C11H11BrN2O2 |
| Molecular Weight |
283.1212 |
| InChI |
InChI=1/C11H11BrN2O2/c12-7-1-2-10-8(4-7)6(5-14-10)3-9(13)11(15)16/h1-2,4-5,9,14H,3,13H2,(H,15,16)/t9-/m1/s1 |
| EINECS |
229-464-4 |
| Molecular Structure |
|
| Density |
1.704g/cm3 |
| Melting point |
264-267℃ |
| Boiling point |
495.8°C at 760 mmHg |
| Refractive index |
1.718 |
| Flash point |
253.7°C |
| Vapour Pressur |
1.19E-10mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
