ChemNet > CAS > 65548-55-2 3',4',7,8-Tetramethoxyflavone
65548-55-2 3',4',7,8-Tetramethoxyflavone
| product Name |
3',4',7,8-Tetramethoxyflavone |
| CAS No |
65548-55-2 |
| Synonyms |
2-(3,4-dimethoxyphenyl)-7,8-dimethoxy-4H-chromen-4-one |
| Molecular Formula |
C19H18O6 |
| Molecular Weight |
342.3426 |
| InChI |
InChI=1/C19H18O6/c1-21-14-7-5-11(9-17(14)23-3)16-10-13(20)12-6-8-15(22-2)19(24-4)18(12)25-16/h5-10H,1-4H3 |
| Molecular Structure |
|
| Density |
1.243g/cm3 |
| Boiling point |
512.1°C at 760 mmHg |
| Refractive index |
1.574 |
| Flash point |
226.3°C |
| Vapour Pressur |
1.33E-10mmHg at 25°C |
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|