ChemNet > CAS > 6575-09-3 2-Chloro-6-methylbenzonitrile
6575-09-3 2-Chloro-6-methylbenzonitrile
| product Name |
2-Chloro-6-methylbenzonitrile |
| CAS No |
6575-09-3 |
| Synonyms |
6-Chloro-o-tolunitrile; 3-chloro-2-toluonitrile |
| Molecular Formula |
C8H6ClN |
| Molecular Weight |
151.5929 |
| InChI |
InChI=1/C8H6ClN/c1-6-3-2-4-8(9)7(6)5-10/h2-4H,1H3 |
| EINECS |
229-499-5 |
| Molecular Structure |
|
| Density |
1.19g/cm3 |
| Melting point |
78-83℃ |
| Boiling point |
241.1°C at 760 mmHg |
| Refractive index |
1.553 |
| Flash point |
110.1°C |
| Vapour Pressur |
0.0367mmHg at 25°C |
| Hazard Symbols |
 Xn:Harmful;
|
| Risk Codes |
R20/21:Harmful by inhalation and in contact with skin.;
|
| Safety Description |
S23:Do not inhale gas/fumes/vapour/spray.;
|
| MSDS |
Material Safety Data Sheet
|
|
