ChemNet > CAS > 6575-13-9 2,6-Dimethylbenzonitrile
6575-13-9 2,6-Dimethylbenzonitrile
| product Name |
2,6-Dimethylbenzonitrile |
| CAS No |
6575-13-9 |
| Synonyms |
2,6-Dimethylbenzoniitrile |
| Molecular Formula |
C9H9N |
| Molecular Weight |
131.1745 |
| InChI |
InChI=1/C9H9N/c1-7-4-3-5-8(2)9(7)6-10/h3-5H,1-2H3 |
| EINECS |
229-503-5 |
| Molecular Structure |
|
| Density |
0.99g/cm3 |
| Melting point |
87-89℃ |
| Boiling point |
228.7°C at 760 mmHg |
| Refractive index |
1.525 |
| Flash point |
91.9°C |
| Vapour Pressur |
0.0725mmHg at 25°C |
| Hazard Symbols |
 Xn:Harmful;
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Safety Description |
S36/37:Wear suitable protective clothing and gloves.;
|
| MSDS |
Material Safety Data Sheet
|
|
