ChemNet > CAS > 6583-06-8 4-Nitro-2,1,3-benzothiadiazole
6583-06-8 4-Nitro-2,1,3-benzothiadiazole
| product Name |
4-Nitro-2,1,3-benzothiadiazole |
| CAS No |
6583-06-8 |
| Synonyms |
4-Nitropiazthiole |
| Molecular Formula |
C6H3N3O2S |
| Molecular Weight |
181.1719 |
| InChI |
InChI=1/C6H3N3O2S/c10-9(11)5-3-1-2-4-6(5)8-12-7-4/h1-3H |
| EINECS |
229-514-5 |
| Molecular Structure |
|
| Density |
1.627g/cm3 |
| Melting point |
106-108℃ |
| Boiling point |
314.3°C at 760 mmHg |
| Refractive index |
1.746 |
| Flash point |
143.9°C |
| Vapour Pressur |
0.000867mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
