ChemNet > CAS > 6587-24-2 methyl 2-cyanobenzoate
6587-24-2 methyl 2-cyanobenzoate
| product Name |
methyl 2-cyanobenzoate |
| CAS No |
6587-24-2 |
| Molecular Formula |
C9H7NO2 |
| Molecular Weight |
161.1574 |
| InChI |
InChI=1/C9H7NO2/c1-12-9(11)8-5-3-2-4-7(8)6-10/h2-5H,1H3 |
| Molecular Structure |
|
| Density |
1.18g/cm3 |
| Melting point |
47℃ |
| Boiling point |
295.8°C at 760 mmHg |
| Refractive index |
1.535 |
| Flash point |
136.2°C |
| Vapour Pressur |
0.00149mmHg at 25°C |
| Hazard Symbols |
 Xn:Harmful;
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Safety Description |
S36/37:Wear suitable protective clothing and gloves.;
|
| MSDS |
Material Safety Data Sheet
|
|
