659-30-3 4-fluorophenylurea
product Name |
4-fluorophenylurea |
CAS No |
659-30-3 |
Synonyms |
Urea, 1-(p-fluorophenyl)-; (4-Fluorophenyl)urea; 1-(p-Fluorophenyl)urea; 4-12-00-01108 (Beilstein Handbook Reference); BRN 2090131; 1-(4-fluorophenyl)urea; 1-(4-fluorophenyl)-1H-pyrrole |
Molecular Formula |
C10H8FN |
Molecular Weight |
161.1756 |
InChI |
InChI=1/C10H8FN/c11-9-3-5-10(6-4-9)12-7-1-2-8-12/h1-8H |
Molecular Structure |
|
Density |
1.07g/cm3 |
Boiling point |
229.7°C at 760 mmHg |
Refractive index |
1.543 |
Flash point |
92.7°C |
Vapour Pressur |
0.104mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|