ChemNet > CAS > 6609-54-7 2-(Methylthio)benzonitrile
6609-54-7 2-(Methylthio)benzonitrile
| product Name |
2-(Methylthio)benzonitrile |
| CAS No |
6609-54-7 |
| Synonyms |
2-Cyanothioanisole~2-(Methylmercapto)benzonitrile; 2-(methylsulfanyl)benzonitrile |
| Molecular Formula |
C8H7NS |
| Molecular Weight |
149.2129 |
| InChI |
InChI=1/C8H7NS/c1-10-8-5-3-2-4-7(8)6-9/h2-5H,1H3 |
| Molecular Structure |
|
| Density |
1.14g/cm3 |
| Boiling point |
263.9°C at 760 mmHg |
| Refractive index |
1.589 |
| Flash point |
113.4°C |
| Vapour Pressur |
0.00999mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Safety Description |
S36/37:Wear suitable protective clothing and gloves.;
|
|
