ChemNet > CAS > 66315-23-9 ethyl 3-amino-4-(methylamino)benzoate
66315-23-9 ethyl 3-amino-4-(methylamino)benzoate
| product Name |
ethyl 3-amino-4-(methylamino)benzoate |
| CAS No |
66315-23-9 |
| Synonyms |
-ETHYL 3-AMINO-4-(METHYLAMINO)BENZOATE; 3-Amino-4-(methylamino)benzoic acid ethyl ester |
| Molecular Formula |
C10H14N2O2 |
| Molecular Weight |
194.2304 |
| InChI |
InChI=1/C10H14N2O2/c1-3-14-10(13)7-4-5-9(12-2)8(11)6-7/h4-6,12H,3,11H2,1-2H3 |
| Molecular Structure |
|
| Density |
1.173g/cm3 |
| Melting point |
81℃ |
| Boiling point |
357.396°C at 760 mmHg |
| Refractive index |
1.598 |
| Flash point |
169.948°C |
| Vapour Pressur |
0mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
