ChemNet > CAS > 6635-41-2 2-Nitrobenzaldoxime
6635-41-2 2-Nitrobenzaldoxime
| product Name |
2-Nitrobenzaldoxime |
| CAS No |
6635-41-2 |
| Synonyms |
2-Nitrobenzaldoxime, (2-Nitrobenzaldehyde oxime); 2-Nitrobenzaldehyde oxime; N-hydroxy-1-(2-nitrophenyl)methanimine |
| Molecular Formula |
C7H6N2O3 |
| Molecular Weight |
166.1341 |
| InChI |
InChI=1/C7H6N2O3/c10-8-5-6-3-1-2-4-7(6)9(11)12/h1-5,10H/b8-5- |
| EINECS |
229-634-8 |
| Molecular Structure |
|
| Density |
1.33g/cm3 |
| Melting point |
98-100℃ |
| Boiling point |
305.2°C at 760 mmHg |
| Refractive index |
1.589 |
| Flash point |
138.4°C |
| Vapour Pressur |
0.000366mmHg at 25°C |
| Hazard Symbols |
 Xn:Harmful;
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
