ChemNet > CAS > 6638-05-7 2,6-Dimethoxy-4-methylphenol
6638-05-7 2,6-Dimethoxy-4-methylphenol
| product Name |
2,6-Dimethoxy-4-methylphenol |
| Synonyms |
4-Methyl-2,6-dimethoxyphenol; 4-Hydroxy-3,5-dimethoxytoluene; 2,6-dimethoxy-4-methyl-phenol; 2,6-dimethoxy-p-cresol; 4-methylsyringol; 4-methylsyringol |
| Molecular Formula |
C9H12O3 |
| Molecular Weight |
168.1898 |
| InChI |
InChI=1/C9H12O3/c1-6-4-7(11-2)9(10)8(5-6)12-3/h4-5,10H,1-3H3 |
| CAS Registry Number |
6638-05-7 |
| EINECS |
229-641-6 |
| Molecular Structure |
|
| Density |
1.105g/cm3 |
| Melting point |
35-146℃ |
| Boiling point |
268.3°C at 760 mmHg |
| Refractive index |
1.52 |
| Flash point |
116.1°C |
| Vapour Pressur |
0.00469mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
2,6-Dimethoxy-4-methylphenol Material Safety Data Sheet
|
|
