ChemNet > CAS > 6670-13-9 4,5-Diphenyl-4-oxazoline-2-thione
6670-13-9 4,5-Diphenyl-4-oxazoline-2-thione
| product Name |
4,5-Diphenyl-4-oxazoline-2-thione |
| CAS No |
6670-13-9 |
| Synonyms |
4,5-Diphenyl-2-oxazolethiol; 4,5-Diphenyl-2-mercaptooxazole; 4,5-diphenyl-1,3-oxazole-2(3H)-thione |
| Molecular Formula |
C15H11NOS |
| Molecular Weight |
253.3189 |
| InChI |
InChI=1/C15H11NOS/c18-15-16-13(11-7-3-1-4-8-11)14(17-15)12-9-5-2-6-10-12/h1-10H,(H,16,18) |
| EINECS |
229-707-4 |
| Molecular Structure |
|
| Density |
1.31g/cm3 |
| Melting point |
256-260℃ |
| Boiling point |
390.6°C at 760 mmHg |
| Refractive index |
1.708 |
| Flash point |
190.1°C |
| Vapour Pressur |
2.61E-06mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
