ChemNet > CAS > 66909-38-4 3-Amino-6-chloro-4-picoline
66909-38-4 3-Amino-6-chloro-4-picoline
| product Name |
3-Amino-6-chloro-4-picoline |
| CAS No |
66909-38-4 |
| Synonyms |
2-CHLORO-4-METHYL-5-AMINOPYRIDINE; 6-chloro-4-methylpyridin-3-amine; 5-Amino-2-chloro-4-methylpyridine; 5-amino-2-chloro-4-picoline |
| Molecular Formula |
C6H7ClN2 |
| Molecular Weight |
142.5862 |
| InChI |
InChI=1/C6H7ClN2/c1-4-2-6(7)9-3-5(4)8/h2-3H,8H2,1H3 |
| Molecular Structure |
|
| Density |
1.26g/cm3 |
| Boiling point |
309.7°C at 760 mmHg |
| Refractive index |
1.592 |
| Flash point |
141.1°C |
| Vapour Pressur |
0.000627mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
