ChemNet > CAS > 66990-30-5 10,12-Tricosadiynoic acid
66990-30-5 10,12-Tricosadiynoic acid
| product Name |
10,12-Tricosadiynoic acid |
| CAS No |
66990-30-5 |
| Synonyms |
tricosa-10,12-diynoic acid |
| Molecular Formula |
C23H38O2 |
| Molecular Weight |
346.5466 |
| InChI |
InChI=1/C23H38O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23(24)25/h2-10,15-22H2,1H3,(H,24,25) |
| Molecular Structure |
|
| Density |
0.938g/cm3 |
| Boiling point |
498.8°C at 760 mmHg |
| Refractive index |
1.486 |
| Flash point |
236°C |
| Vapour Pressur |
2.62E-11mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
