ChemNet > CAS > 6705-03-9 2-Amino-5-methoxybenzoic acid
6705-03-9 2-Amino-5-methoxybenzoic acid
| product Name |
2-Amino-5-methoxybenzoic acid |
| CAS No |
6705-03-9 |
| Synonyms |
5-Methoxyanthranilic acid; 2-Amino-5-methoxy-benzoic acid |
| Molecular Formula |
C8H8N2O |
| Molecular Weight |
148.1619 |
| InChI |
InChI=1/C8H8N2O/c1-11-7-2-3-8(10)6(4-7)5-9/h2-4H,10H2,1H3 |
| Molecular Structure |
|
| Density |
1.17g/cm3 |
| Melting point |
148-152℃ |
| Boiling point |
302.2°C at 760 mmHg |
| Refractive index |
1.569 |
| Flash point |
136.6°C |
| Vapour Pressur |
0.00101mmHg at 25°C |
| Hazard Symbols |
 Xn:Harmful;
|
| Risk Codes |
R22:;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
