ChemNet > CAS > 67442-07-3 2-Chloro-N-methoxy-N-methylacetamide
67442-07-3 2-Chloro-N-methoxy-N-methylacetamide
| product Name |
2-Chloro-N-methoxy-N-methylacetamide |
| CAS No |
67442-07-3 |
| Synonyms |
Acetamide, 2-chloro-N-methoxy-N-methyl-; N-Methyl-N-methoxy-2-chloroacetamide |
| Molecular Formula |
C4H8ClNO2 |
| Molecular Weight |
137.5648 |
| InChI |
InChI=1/C4H8ClNO2/c1-6(8-2)4(7)3-5/h3H2,1-2H3 |
| Molecular Structure |
|
| Density |
1.178g/cm3 |
| Melting point |
39-41℃ |
| Boiling point |
141.5°C at 760 mmHg |
| Refractive index |
1.442 |
| Flash point |
39.4°C |
| Vapour Pressur |
5.83mmHg at 25°C |
| Hazard Symbols |
 Xn:Harmful;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
| MSDS |
Material Safety Data Sheet
|
|
