ChemNet > CAS > 67565-48-4 4-(4-Nitrobenzyloxy)benzaldehyde
67565-48-4 4-(4-Nitrobenzyloxy)benzaldehyde
| product Name |
4-(4-Nitrobenzyloxy)benzaldehyde |
| CAS No |
67565-48-4 |
| Molecular Formula |
C14H11NO4 |
| Molecular Weight |
257.2414 |
| InChI |
InChI=1/C14H11NO4/c16-9-11-3-7-14(8-4-11)19-10-12-1-5-13(6-2-12)15(17)18/h1-9H,10H2 |
| Molecular Structure |
|
| Density |
1.301g/cm3 |
| Boiling point |
456.6°C at 760 mmHg |
| Refractive index |
1.634 |
| Flash point |
211°C |
| Vapour Pressur |
1.6E-08mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
