ChemNet > CAS > 6760-14-1 2-Amino-5-nitronicotinic acid
6760-14-1 2-Amino-5-nitronicotinic acid
| product Name |
2-Amino-5-nitronicotinic acid |
| CAS No |
6760-14-1 |
| Synonyms |
2-amino-5-nitropyridine-3-carboxylic acid |
| Molecular Formula |
C6H5N3O4 |
| Molecular Weight |
183.1216 |
| InChI |
InChI=1/C6H5N3O4/c7-5-4(6(10)11)1-3(2-8-5)9(12)13/h1-2H,(H2,7,8)(H,10,11) |
| Molecular Structure |
|
| Density |
1.675g/cm3 |
| Boiling point |
457.4°C at 760 mmHg |
| Refractive index |
1.695 |
| Flash point |
230.4°C |
| Vapour Pressur |
3.68E-09mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
