ChemNet > CAS > 67801-50-7 isononanoic acid, compound with 2-aminoethanol (1:1)
67801-50-7 isononanoic acid, compound with 2-aminoethanol (1:1)
| product Name |
isononanoic acid, compound with 2-aminoethanol (1:1) |
| CAS No |
67801-50-7 |
| Synonyms |
Isononanoic acid, compd. with 2-aminoethanol (1:1); Isononanoic acid monoethanolamine salt; Isononanoic acid, monoethanolamine salt; Isononanoic acid, compound with 2-aminoethanol (1:1); 7-methyloctanoic acid - 2-aminoethanol (1:1) |
| Molecular Formula |
C11H25NO3 |
| Molecular Weight |
219.3211 |
| InChI |
InChI=1/C9H18O2.C2H7NO/c1-8(2)6-4-3-5-7-9(10)11;3-1-2-4/h8H,3-7H2,1-2H3,(H,10,11);4H,1-3H2 |
| EINECS |
267-169-2 |
| Molecular Structure |
|
| Boiling point |
253.4°C at 760 mmHg |
| Flash point |
129.7°C |
| Vapour Pressur |
0.0057mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|
