ChemNet > CAS > 6781-42-6 1,3-Diacetylbenzene
6781-42-6 1,3-Diacetylbenzene
| product Name |
1,3-Diacetylbenzene |
| CAS No |
6781-42-6 |
| Synonyms |
benzene-1,3-bis(acetyl); 1,1'-benzene-1,3-diyldiethanone; m-Diacetylbenzene |
| Molecular Formula |
C10H10O2 |
| Molecular Weight |
162.1852 |
| InChI |
InChI=1/C10H10O2/c1-7(11)9-4-3-5-10(6-9)8(2)12/h3-6H,1-2H3 |
| EINECS |
229-842-9 |
| Molecular Structure |
|
| Density |
1.063g/cm3 |
| Melting point |
35-37℃ |
| Boiling point |
280.3°C at 760 mmHg |
| Refractive index |
1.519 |
| Flash point |
108.5°C |
| Vapour Pressur |
0.00382mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
