ChemNet > CAS > 67858-47-3 methyl 4-formyl-1-methyl-1H-pyrrole-2-carboxylate
67858-47-3 methyl 4-formyl-1-methyl-1H-pyrrole-2-carboxylate
| product Name |
methyl 4-formyl-1-methyl-1H-pyrrole-2-carboxylate |
| CAS No |
67858-47-3 |
| Synonyms |
4-Formyl-2-methoxycarbonyl-N-methylpyrrole; methyl 4-formyl-1H-pyrrole-2-carboxylate |
| Molecular Formula |
C8H9NO3 |
| Molecular Weight |
167.162 |
| InChI |
InChI=1/C8H9NO3/c1-9-4-6(5-10)3-7(9)8(11)12-2/h3-5H,1-2H3 |
| Molecular Structure |
|
| Density |
1.16g/cm3 |
| Melting point |
96℃ |
| Boiling point |
293.1°C at 760 mmHg |
| Refractive index |
1.521 |
| Flash point |
131.1°C |
| Vapour Pressur |
0.00176mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
