ChemNet > CAS > 67973-32-4 3,5-Dibromo-4-methylbenzoic acid
67973-32-4 3,5-Dibromo-4-methylbenzoic acid
| product Name |
3,5-Dibromo-4-methylbenzoic acid |
| CAS No |
67973-32-4 |
| Synonyms |
3,5-Dibromo-p-toluic acid (COOH=1); 3,5-Dibromo-p-toluic acid |
| Molecular Formula |
C8H6Br2O2 |
| Molecular Weight |
293.94 |
| InChI |
InChI=1/C8H6Br2O2/c1-4-6(9)2-5(8(11)12)3-7(4)10/h2-3H,1H3,(H,11,12) |
| Molecular Structure |
|
| Density |
1.951g/cm3 |
| Boiling point |
374.6°C at 760 mmHg |
| Refractive index |
1.627 |
| Flash point |
180.3°C |
| Vapour Pressur |
2.82E-06mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
